C12H18N2O4 — CID 106174794
2-hydroxy-3-[2-(2-methoxyphenoxy)ethylamino]propanamide (PubChem CID 106174794) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-hydroxy-3-[2-(2-methoxyphenoxy)ethylamino]propanamide.
| Compound Name | 2-hydroxy-3-[2-(2-methoxyphenoxy)ethylamino]propanamide |
|---|---|
| PubChem CID | 106174794 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 2-hydroxy-3-[2-(2-methoxyphenoxy)ethylamino]propanamide |
| SMILES | COc1ccccc1OCCNCC(O)C(N)=O |
| InChI | InChI=1S/C12H18N2O4/c1-17-10-4-2-3-5-11(10)18-7-6-14-8-9(15)12(13)16/h2-5,9,14-15H,6-8H2,1H3,(H2,13,16) |
| InChIKey | UDHVPNPZFGJQPG-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|