C11H15N3OS — CID 106435664
2-[(1-ethylimidazol-2-yl)amino]-1-thiophen-3-ylethanol (PubChem CID 106435664) has the molecular formula C11H15N3OS and a molecular weight of 237.33 g/mol. Its IUPAC name is 2-[(1-ethylimidazol-2-yl)amino]-1-thiophen-3-ylethanol.
| Compound Name | 2-[(1-ethylimidazol-2-yl)amino]-1-thiophen-3-ylethanol |
|---|---|
| PubChem CID | 106435664 |
| Molecular Formula | C11H15N3OS |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 2-[(1-ethylimidazol-2-yl)amino]-1-thiophen-3-ylethanol |
| SMILES | CCn1ccnc1NCC(O)c1ccsc1 |
| InChI | InChI=1S/C11H15N3OS/c1-2-14-5-4-12-11(14)13-7-10(15)9-3-6-16-8-9/h3-6,8,10,15H,2,7H2,1H3,(H,12,13) |
| InChIKey | XBRBFJJLJUNAQB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |