C13H18N4 — CID 55256491
N'-(1-ethylimidazol-2-yl)-1-phenylethane-1,2-diamine (PubChem CID 55256491) has the molecular formula C13H18N4 and a molecular weight of 230.32 g/mol. Its IUPAC name is N'-(1-ethylimidazol-2-yl)-1-phenylethane-1,2-diamine.
| Compound Name | N'-(1-ethylimidazol-2-yl)-1-phenylethane-1,2-diamine |
|---|---|
| PubChem CID | 55256491 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.32 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | N'-(1-ethylimidazol-2-yl)-1-phenylethane-1,2-diamine |
| SMILES | CCn1ccnc1NCC(N)c1ccccc1 |
| InChI | InChI=1S/C13H18N4/c1-2-17-9-8-15-13(17)16-10-12(14)11-6-4-3-5-7-11/h3-9,12H,2,10,14H2,1H3,(H,15,16) |
| InChIKey | GWNNVGBRWIFNQH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |