C10H20N4O — CID 106244489
1-N-(1-ethylimidazol-2-yl)-4-methoxybutane-1,3-diamine (PubChem CID 106244489) has the molecular formula C10H20N4O and a molecular weight of 212.30 g/mol. Its IUPAC name is 1-N-(1-ethylimidazol-2-yl)-4-methoxybutane-1,3-diamine.
| Compound Name | 1-N-(1-ethylimidazol-2-yl)-4-methoxybutane-1,3-diamine |
|---|---|
| PubChem CID | 106244489 |
| Molecular Formula | C10H20N4O |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | 1-N-(1-ethylimidazol-2-yl)-4-methoxybutane-1,3-diamine |
| SMILES | CCn1ccnc1NCCC(N)COC |
| InChI | InChI=1S/C10H20N4O/c1-3-14-7-6-13-10(14)12-5-4-9(11)8-15-2/h6-7,9H,3-5,8,11H2,1-2H3,(H,12,13) |
| InChIKey | IGBOBAXEPULZKL-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |