C9H18N4O — CID 106182281
2-N-(1-ethylimidazol-2-yl)-3-methoxypropane-1,2-diamine (PubChem CID 106182281) has the molecular formula C9H18N4O and a molecular weight of 198.27 g/mol. Its IUPAC name is 2-N-(1-ethylimidazol-2-yl)-3-methoxypropane-1,2-diamine.
| Compound Name | 2-N-(1-ethylimidazol-2-yl)-3-methoxypropane-1,2-diamine |
|---|---|
| PubChem CID | 106182281 |
| Molecular Formula | C9H18N4O |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.15 |
| IUPAC Name | 2-N-(1-ethylimidazol-2-yl)-3-methoxypropane-1,2-diamine |
| SMILES | CCn1ccnc1NC(CN)COC |
| InChI | InChI=1S/C9H18N4O/c1-3-13-5-4-11-9(13)12-8(6-10)7-14-2/h4-5,8H,3,6-7,10H2,1-2H3,(H,11,12) |
| InChIKey | GZYHXCXOELBYGQ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |