C9H17N3O2 — CID 106186173
2-[(1-ethylimidazol-2-yl)amino]-3-methoxypropan-1-ol (PubChem CID 106186173) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is 2-[(1-ethylimidazol-2-yl)amino]-3-methoxypropan-1-ol.
| Compound Name | 2-[(1-ethylimidazol-2-yl)amino]-3-methoxypropan-1-ol |
|---|---|
| PubChem CID | 106186173 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | 2-[(1-ethylimidazol-2-yl)amino]-3-methoxypropan-1-ol |
| SMILES | CCn1ccnc1NC(CO)COC |
| InChI | InChI=1S/C9H17N3O2/c1-3-12-5-4-10-9(12)11-8(6-13)7-14-2/h4-5,8,13H,3,6-7H2,1-2H3,(H,10,11) |
| InChIKey | JBFXMVVJUAZGCG-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |