C11H19N3O3 — CID 114210811
1-ethyl-3-[(1-hydroxy-4-methoxybutan-2-yl)amino]pyrazin-2-one (PubChem CID 114210811) has the molecular formula C11H19N3O3 and a molecular weight of 241.29 g/mol. Its IUPAC name is 1-ethyl-3-[(1-hydroxy-4-methoxybutan-2-yl)amino]pyrazin-2-one.
| Compound Name | 1-ethyl-3-[(1-hydroxy-4-methoxybutan-2-yl)amino]pyrazin-2-one |
|---|---|
| PubChem CID | 114210811 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 1-ethyl-3-[(1-hydroxy-4-methoxybutan-2-yl)amino]pyrazin-2-one |
| SMILES | CCn1ccnc(NC(CO)CCOC)c1=O |
| InChI | InChI=1S/C11H19N3O3/c1-3-14-6-5-12-10(11(14)16)13-9(8-15)4-7-17-2/h5-6,9,15H,3-4,7-8H2,1-2H3,(H,12,13) |
| InChIKey | DCUJGISVFDKDDM-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |