C10H20N4 — CID 62138038
N-(1-ethylimidazol-2-yl)-N',N'-dimethylpropane-1,3-diamine (PubChem CID 62138038) has the molecular formula C10H20N4 and a molecular weight of 196.30 g/mol. Its IUPAC name is N-(1-ethylimidazol-2-yl)-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-(1-ethylimidazol-2-yl)-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 62138038 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | N-(1-ethylimidazol-2-yl)-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CCn1ccnc1NCCCN(C)C |
| InChI | InChI=1S/C10H20N4/c1-4-14-9-7-12-10(14)11-6-5-8-13(2)3/h7,9H,4-6,8H2,1-3H3,(H,11,12) |
| InChIKey | MHWVAMGFBPWVSK-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|