C14H28N4O — CID 106558814
N',N'-diethyl-N-[1-(3-methoxypropyl)imidazol-2-yl]propane-1,3-diamine (PubChem CID 106558814) has the molecular formula C14H28N4O and a molecular weight of 268.40 g/mol. Its IUPAC name is N',N'-diethyl-N-[1-(3-methoxypropyl)imidazol-2-yl]propane-1,3-diamine.
| Compound Name | N',N'-diethyl-N-[1-(3-methoxypropyl)imidazol-2-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 106558814 |
| Molecular Formula | C14H28N4O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.23 |
| IUPAC Name | N',N'-diethyl-N-[1-(3-methoxypropyl)imidazol-2-yl]propane-1,3-diamine |
| SMILES | CCN(CC)CCCNc1nccn1CCCOC |
| InChI | InChI=1S/C14H28N4O/c1-4-17(5-2)10-6-8-15-14-16-9-12-18(14)11-7-13-19-3/h9,12H,4-8,10-11,13H2,1-3H3,(H,15,16) |
| InChIKey | UOBOPDRUFYBVEN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|