C15H30N4O — CID 106555590
1-[2-[di(propan-2-yl)amino]ethyl]-N-(3-methoxypropyl)imidazol-2-amine (PubChem CID 106555590) has the molecular formula C15H30N4O and a molecular weight of 282.43 g/mol. Its IUPAC name is 1-[2-[di(propan-2-yl)amino]ethyl]-N-(3-methoxypropyl)imidazol-2-amine.
| Compound Name | 1-[2-[di(propan-2-yl)amino]ethyl]-N-(3-methoxypropyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106555590 |
| Molecular Formula | C15H30N4O |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.24 |
| IUPAC Name | 1-[2-[di(propan-2-yl)amino]ethyl]-N-(3-methoxypropyl)imidazol-2-amine |
| SMILES | COCCCNc1nccn1CCN(C(C)C)C(C)C |
| InChI | InChI=1S/C15H30N4O/c1-13(2)19(14(3)4)11-10-18-9-8-17-15(18)16-7-6-12-20-5/h8-9,13-14H,6-7,10-12H2,1-5H3,(H,16,17) |
| InChIKey | PKPAMGIXZPMTRO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|