C14H27N3O3 — CID 106581197
1-[4-(2-methoxyethoxy)butyl]-N-(3-methoxypropyl)imidazol-2-amine (PubChem CID 106581197) has the molecular formula C14H27N3O3 and a molecular weight of 285.39 g/mol. Its IUPAC name is 1-[4-(2-methoxyethoxy)butyl]-N-(3-methoxypropyl)imidazol-2-amine.
| Compound Name | 1-[4-(2-methoxyethoxy)butyl]-N-(3-methoxypropyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106581197 |
| Molecular Formula | C14H27N3O3 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | 1-[4-(2-methoxyethoxy)butyl]-N-(3-methoxypropyl)imidazol-2-amine |
| SMILES | COCCCNc1nccn1CCCCOCCOC |
| InChI | InChI=1S/C14H27N3O3/c1-18-10-5-6-15-14-16-7-9-17(14)8-3-4-11-20-13-12-19-2/h7,9H,3-6,8,10-13H2,1-2H3,(H,15,16) |
| InChIKey | XACITSPPQKBNHR-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 57.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|