C10H19N3O — CID 106565023
N-ethyl-1-(4-methoxybutyl)imidazol-2-amine (PubChem CID 106565023) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is N-ethyl-1-(4-methoxybutyl)imidazol-2-amine.
| Compound Name | N-ethyl-1-(4-methoxybutyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106565023 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | N-ethyl-1-(4-methoxybutyl)imidazol-2-amine |
| SMILES | CCNc1nccn1CCCCOC |
| InChI | InChI=1S/C10H19N3O/c1-3-11-10-12-6-8-13(10)7-4-5-9-14-2/h6,8H,3-5,7,9H2,1-2H3,(H,11,12) |
| InChIKey | LLVMFGAZTHCISB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|