C14H27N3O2 — CID 106581195
1-butyl-N-[4-(2-methoxyethoxy)butyl]imidazol-2-amine (PubChem CID 106581195) has the molecular formula C14H27N3O2 and a molecular weight of 269.39 g/mol. Its IUPAC name is 1-butyl-N-[4-(2-methoxyethoxy)butyl]imidazol-2-amine.
| Compound Name | 1-butyl-N-[4-(2-methoxyethoxy)butyl]imidazol-2-amine |
|---|---|
| PubChem CID | 106581195 |
| Molecular Formula | C14H27N3O2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | 1-butyl-N-[4-(2-methoxyethoxy)butyl]imidazol-2-amine |
| SMILES | CCCCn1ccnc1NCCCCOCCOC |
| InChI | InChI=1S/C14H27N3O2/c1-3-4-9-17-10-8-16-14(17)15-7-5-6-11-19-13-12-18-2/h8,10H,3-7,9,11-13H2,1-2H3,(H,15,16) |
| InChIKey | NWHASLILCOJYMJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|