C14H20N4 — CID 80507516
N'-(1-ethylimidazol-2-yl)-1-phenylpropane-1,3-diamine (PubChem CID 80507516) has the molecular formula C14H20N4 and a molecular weight of 244.34 g/mol. Its IUPAC name is N'-(1-ethylimidazol-2-yl)-1-phenylpropane-1,3-diamine.
| Compound Name | N'-(1-ethylimidazol-2-yl)-1-phenylpropane-1,3-diamine |
|---|---|
| PubChem CID | 80507516 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | N'-(1-ethylimidazol-2-yl)-1-phenylpropane-1,3-diamine |
| SMILES | CCn1ccnc1NCCC(N)c1ccccc1 |
| InChI | InChI=1S/C14H20N4/c1-2-18-11-10-17-14(18)16-9-8-13(15)12-6-4-3-5-7-12/h3-7,10-11,13H,2,8-9,15H2,1H3,(H,16,17) |
| InChIKey | UDQNTKXVOADTDM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |