C15H15ClN4 — CID 107061358
2-[(3-amino-3-phenylpropyl)amino]-3-chloropyridine-4-carbonitrile (PubChem CID 107061358) has the molecular formula C15H15ClN4 and a molecular weight of 286.77 g/mol. Its IUPAC name is 2-[(3-amino-3-phenylpropyl)amino]-3-chloropyridine-4-carbonitrile.
| Compound Name | 2-[(3-amino-3-phenylpropyl)amino]-3-chloropyridine-4-carbonitrile |
|---|---|
| PubChem CID | 107061358 |
| Molecular Formula | C15H15ClN4 |
| Molecular Weight | 286.77 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 2-[(3-amino-3-phenylpropyl)amino]-3-chloropyridine-4-carbonitrile |
| SMILES | N#Cc1ccnc(NCCC(N)c2ccccc2)c1Cl |
| InChI | InChI=1S/C15H15ClN4/c16-14-12(10-17)6-8-19-15(14)20-9-7-13(18)11-4-2-1-3-5-11/h1-6,8,13H,7,9,18H2,(H,19,20) |
| InChIKey | WTUBHEGXIIBJCN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.77 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |