C13H16N4 — CID 80506681
1-phenyl-N'-pyrimidin-2-ylpropane-1,3-diamine (PubChem CID 80506681) has the molecular formula C13H16N4 and a molecular weight of 228.30 g/mol. Its IUPAC name is 1-phenyl-N'-pyrimidin-2-ylpropane-1,3-diamine.
| Compound Name | 1-phenyl-N'-pyrimidin-2-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 80506681 |
| Molecular Formula | C13H16N4 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 1-phenyl-N'-pyrimidin-2-ylpropane-1,3-diamine |
| SMILES | NC(CCNc1ncccn1)c1ccccc1 |
| InChI | InChI=1S/C13H16N4/c14-12(11-5-2-1-3-6-11)7-10-17-13-15-8-4-9-16-13/h1-6,8-9,12H,7,10,14H2,(H,15,16,17) |
| InChIKey | RAHHOKFQWGZQBE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |