C10H17N3O3 — CID 103153802
4-[(1-ethylimidazol-2-yl)amino]-3-methoxybutanoic acid (PubChem CID 103153802) has the molecular formula C10H17N3O3 and a molecular weight of 227.26 g/mol. Its IUPAC name is 4-[(1-ethylimidazol-2-yl)amino]-3-methoxybutanoic acid.
| Compound Name | 4-[(1-ethylimidazol-2-yl)amino]-3-methoxybutanoic acid |
|---|---|
| PubChem CID | 103153802 |
| Molecular Formula | C10H17N3O3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 4-[(1-ethylimidazol-2-yl)amino]-3-methoxybutanoic acid |
| SMILES | CCn1ccnc1NCC(CC(=O)O)OC |
| InChI | InChI=1S/C10H17N3O3/c1-3-13-5-4-11-10(13)12-7-8(16-2)6-9(14)15/h4-5,8H,3,6-7H2,1-2H3,(H,11,12)(H,14,15) |
| InChIKey | IXBRFILTBOFUFN-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |