C14H15BrN2O3 — CID 106536504
4-[(5-bromoisoquinolin-1-yl)amino]-3-methoxybutanoic acid (PubChem CID 106536504) has the molecular formula C14H15BrN2O3 and a molecular weight of 339.19 g/mol. Its IUPAC name is 4-[(5-bromoisoquinolin-1-yl)amino]-3-methoxybutanoic acid.
| Compound Name | 4-[(5-bromoisoquinolin-1-yl)amino]-3-methoxybutanoic acid |
|---|---|
| PubChem CID | 106536504 |
| Molecular Formula | C14H15BrN2O3 |
| Molecular Weight | 339.19 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 4-[(5-bromoisoquinolin-1-yl)amino]-3-methoxybutanoic acid |
| SMILES | COC(CNc1nccc2c(Br)cccc12)CC(=O)O |
| InChI | InChI=1S/C14H15BrN2O3/c1-20-9(7-13(18)19)8-17-14-11-3-2-4-12(15)10(11)5-6-16-14/h2-6,9H,7-8H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | WLSBOZODXWJRKU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.19 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |