C14H16BrN3O — CID 106238554
5-[(5-bromoisoquinolin-1-yl)amino]pentanamide (PubChem CID 106238554) has the molecular formula C14H16BrN3O and a molecular weight of 322.21 g/mol. Its IUPAC name is 5-[(5-bromoisoquinolin-1-yl)amino]pentanamide.
| Compound Name | 5-[(5-bromoisoquinolin-1-yl)amino]pentanamide |
|---|---|
| PubChem CID | 106238554 |
| Molecular Formula | C14H16BrN3O |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 5-[(5-bromoisoquinolin-1-yl)amino]pentanamide |
| SMILES | NC(=O)CCCCNc1nccc2c(Br)cccc12 |
| InChI | InChI=1S/C14H16BrN3O/c15-12-5-3-4-11-10(12)7-9-18-14(11)17-8-2-1-6-13(16)19/h3-5,7,9H,1-2,6,8H2,(H2,16,19)(H,17,18) |
| InChIKey | VOAJRHDEEWLYFY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|