C15H19N3O2 — CID 106238801
5-[(5-methoxyisoquinolin-1-yl)amino]pentanamide (PubChem CID 106238801) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 5-[(5-methoxyisoquinolin-1-yl)amino]pentanamide.
| Compound Name | 5-[(5-methoxyisoquinolin-1-yl)amino]pentanamide |
|---|---|
| PubChem CID | 106238801 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 5-[(5-methoxyisoquinolin-1-yl)amino]pentanamide |
| SMILES | COc1cccc2c(NCCCCC(N)=O)nccc12 |
| InChI | InChI=1S/C15H19N3O2/c1-20-13-6-4-5-12-11(13)8-10-18-15(12)17-9-3-2-7-14(16)19/h4-6,8,10H,2-3,7,9H2,1H3,(H2,16,19)(H,17,18) |
| InChIKey | YUKDNKPHZLBEOR-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|