C12H22ClN3 — CID 107156123
N-(2-chloro-4,4-dimethylpentyl)-1-ethylimidazol-2-amine (PubChem CID 107156123) has the molecular formula C12H22ClN3 and a molecular weight of 243.78 g/mol. Its IUPAC name is N-(2-chloro-4,4-dimethylpentyl)-1-ethylimidazol-2-amine.
| Compound Name | N-(2-chloro-4,4-dimethylpentyl)-1-ethylimidazol-2-amine |
|---|---|
| PubChem CID | 107156123 |
| Molecular Formula | C12H22ClN3 |
| Molecular Weight | 243.78 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | N-(2-chloro-4,4-dimethylpentyl)-1-ethylimidazol-2-amine |
| SMILES | CCn1ccnc1NCC(Cl)CC(C)(C)C |
| InChI | InChI=1S/C12H22ClN3/c1-5-16-7-6-14-11(16)15-9-10(13)8-12(2,3)4/h6-7,10H,5,8-9H2,1-4H3,(H,14,15) |
| InChIKey | IYLRZFYHTOCQIT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.78 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|