C13H24ClN3 — CID 107155741
2-chloro-4,4-dimethyl-N-[2-(1-methylimidazol-2-yl)ethyl]pentan-1-amine (PubChem CID 107155741) has the molecular formula C13H24ClN3 and a molecular weight of 257.81 g/mol. Its IUPAC name is 2-chloro-4,4-dimethyl-N-[2-(1-methylimidazol-2-yl)ethyl]pentan-1-amine.
| Compound Name | 2-chloro-4,4-dimethyl-N-[2-(1-methylimidazol-2-yl)ethyl]pentan-1-amine |
|---|---|
| PubChem CID | 107155741 |
| Molecular Formula | C13H24ClN3 |
| Molecular Weight | 257.81 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | 2-chloro-4,4-dimethyl-N-[2-(1-methylimidazol-2-yl)ethyl]pentan-1-amine |
| SMILES | Cn1ccnc1CCNCC(Cl)CC(C)(C)C |
| InChI | InChI=1S/C13H24ClN3/c1-13(2,3)9-11(14)10-15-6-5-12-16-7-8-17(12)4/h7-8,11,15H,5-6,9-10H2,1-4H3 |
| InChIKey | CYCWYIBASFAYHU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.81 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|