C12H23N3O2S — CID 106723544
N-(2-tert-butylsulfonylethyl)-2-(1-methylimidazol-2-yl)ethanamine (PubChem CID 106723544) has the molecular formula C12H23N3O2S and a molecular weight of 273.40 g/mol. Its IUPAC name is N-(2-tert-butylsulfonylethyl)-2-(1-methylimidazol-2-yl)ethanamine.
| Compound Name | N-(2-tert-butylsulfonylethyl)-2-(1-methylimidazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 106723544 |
| Molecular Formula | C12H23N3O2S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | N-(2-tert-butylsulfonylethyl)-2-(1-methylimidazol-2-yl)ethanamine |
| SMILES | Cn1ccnc1CCNCCS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C12H23N3O2S/c1-12(2,3)18(16,17)10-8-13-6-5-11-14-7-9-15(11)4/h7,9,13H,5-6,8,10H2,1-4H3 |
| InChIKey | GLETWKKOMPRMDR-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|