C12H14FN5O — CID 80907262
2-[(5-fluoro-2-hydrazinylpyrimidin-4-yl)amino]-1-phenylethanol (PubChem CID 80907262) has the molecular formula C12H14FN5O and a molecular weight of 263.28 g/mol. Its IUPAC name is 2-[(5-fluoro-2-hydrazinylpyrimidin-4-yl)amino]-1-phenylethanol.
| Compound Name | 2-[(5-fluoro-2-hydrazinylpyrimidin-4-yl)amino]-1-phenylethanol |
|---|---|
| PubChem CID | 80907262 |
| Molecular Formula | C12H14FN5O |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 2-[(5-fluoro-2-hydrazinylpyrimidin-4-yl)amino]-1-phenylethanol |
| SMILES | NNc1ncc(F)c(NCC(O)c2ccccc2)n1 |
| InChI | InChI=1S/C12H14FN5O/c13-9-6-16-12(18-14)17-11(9)15-7-10(19)8-4-2-1-3-5-8/h1-6,10,19H,7,14H2,(H2,15,16,17,18) |
| InChIKey | DOMMUONLEWGCOG-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|