C15H22N4OS — CID 106436326
2-[[2-tert-butyl-6-(methylamino)pyrimidin-4-yl]amino]-1-thiophen-3-ylethanol (PubChem CID 106436326) has the molecular formula C15H22N4OS and a molecular weight of 306.44 g/mol. Its IUPAC name is 2-[[2-tert-butyl-6-(methylamino)pyrimidin-4-yl]amino]-1-thiophen-3-ylethanol.
| Compound Name | 2-[[2-tert-butyl-6-(methylamino)pyrimidin-4-yl]amino]-1-thiophen-3-ylethanol |
|---|---|
| PubChem CID | 106436326 |
| Molecular Formula | C15H22N4OS |
| Molecular Weight | 306.44 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 2-[[2-tert-butyl-6-(methylamino)pyrimidin-4-yl]amino]-1-thiophen-3-ylethanol |
| SMILES | CNc1cc(NCC(O)c2ccsc2)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C15H22N4OS/c1-15(2,3)14-18-12(16-4)7-13(19-14)17-8-11(20)10-5-6-21-9-10/h5-7,9,11,20H,8H2,1-4H3,(H2,16,17,18,19) |
| InChIKey | CJZOLCHLYHYFIM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |