C14H17FN2O2S — CID 106434546
2-(2-amino-5-ethoxy-4-fluoroanilino)-1-thiophen-3-ylethanol (PubChem CID 106434546) has the molecular formula C14H17FN2O2S and a molecular weight of 296.37 g/mol. Its IUPAC name is 2-(2-amino-5-ethoxy-4-fluoroanilino)-1-thiophen-3-ylethanol.
| Compound Name | 2-(2-amino-5-ethoxy-4-fluoroanilino)-1-thiophen-3-ylethanol |
|---|---|
| PubChem CID | 106434546 |
| Molecular Formula | C14H17FN2O2S |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 2-(2-amino-5-ethoxy-4-fluoroanilino)-1-thiophen-3-ylethanol |
| SMILES | CCOc1cc(NCC(O)c2ccsc2)c(N)cc1F |
| InChI | InChI=1S/C14H17FN2O2S/c1-2-19-14-6-12(11(16)5-10(14)15)17-7-13(18)9-3-4-20-8-9/h3-6,8,13,17-18H,2,7,16H2,1H3 |
| InChIKey | FSJOJTTUMOWLRP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|