C12H18FN3O3 — CID 106166701
3-(2-amino-4-fluoro-5-propoxyanilino)-2-hydroxypropanamide (PubChem CID 106166701) has the molecular formula C12H18FN3O3 and a molecular weight of 271.29 g/mol. Its IUPAC name is 3-(2-amino-4-fluoro-5-propoxyanilino)-2-hydroxypropanamide.
| Compound Name | 3-(2-amino-4-fluoro-5-propoxyanilino)-2-hydroxypropanamide |
|---|---|
| PubChem CID | 106166701 |
| Molecular Formula | C12H18FN3O3 |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 3-(2-amino-4-fluoro-5-propoxyanilino)-2-hydroxypropanamide |
| SMILES | CCCOc1cc(NCC(O)C(N)=O)c(N)cc1F |
| InChI | InChI=1S/C12H18FN3O3/c1-2-3-19-11-5-9(8(14)4-7(11)13)16-6-10(17)12(15)18/h4-5,10,16-17H,2-3,6,14H2,1H3,(H2,15,18) |
| InChIKey | QJHBLTSTVJUXRZ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|