C14H23FN2O3 — CID 107864615
2-(2-amino-4-fluoro-5-propoxyanilino)-2-ethylpropane-1,3-diol (PubChem CID 107864615) has the molecular formula C14H23FN2O3 and a molecular weight of 286.35 g/mol. Its IUPAC name is 2-(2-amino-4-fluoro-5-propoxyanilino)-2-ethylpropane-1,3-diol.
| Compound Name | 2-(2-amino-4-fluoro-5-propoxyanilino)-2-ethylpropane-1,3-diol |
|---|---|
| PubChem CID | 107864615 |
| Molecular Formula | C14H23FN2O3 |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 2-(2-amino-4-fluoro-5-propoxyanilino)-2-ethylpropane-1,3-diol |
| SMILES | CCCOc1cc(NC(CC)(CO)CO)c(N)cc1F |
| InChI | InChI=1S/C14H23FN2O3/c1-3-5-20-13-7-12(11(16)6-10(13)15)17-14(4-2,8-18)9-19/h6-7,17-19H,3-5,8-9,16H2,1-2H3 |
| InChIKey | GFVBGZDCGVNQFD-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|