C13H22N2O4 — CID 107845644
2-(2-amino-3-propoxyanilino)-2-(hydroxymethyl)propane-1,3-diol (PubChem CID 107845644) has the molecular formula C13H22N2O4 and a molecular weight of 270.33 g/mol. Its IUPAC name is 2-(2-amino-3-propoxyanilino)-2-(hydroxymethyl)propane-1,3-diol.
| Compound Name | 2-(2-amino-3-propoxyanilino)-2-(hydroxymethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 107845644 |
| Molecular Formula | C13H22N2O4 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 2-(2-amino-3-propoxyanilino)-2-(hydroxymethyl)propane-1,3-diol |
| SMILES | CCCOc1cccc(NC(CO)(CO)CO)c1N |
| InChI | InChI=1S/C13H22N2O4/c1-2-6-19-11-5-3-4-10(12(11)14)15-13(7-16,8-17)9-18/h3-5,15-18H,2,6-9,14H2,1H3 |
| InChIKey | VMECERPYWBZGCA-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|