C18H22N2O — CID 107844538
1-N-(2,3-dihydro-1H-inden-2-yl)-3-propoxybenzene-1,2-diamine (PubChem CID 107844538) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is 1-N-(2,3-dihydro-1H-inden-2-yl)-3-propoxybenzene-1,2-diamine.
| Compound Name | 1-N-(2,3-dihydro-1H-inden-2-yl)-3-propoxybenzene-1,2-diamine |
|---|---|
| PubChem CID | 107844538 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 1-N-(2,3-dihydro-1H-inden-2-yl)-3-propoxybenzene-1,2-diamine |
| SMILES | CCCOc1cccc(NC2Cc3ccccc3C2)c1N |
| InChI | InChI=1S/C18H22N2O/c1-2-10-21-17-9-5-8-16(18(17)19)20-15-11-13-6-3-4-7-14(13)12-15/h3-9,15,20H,2,10-12,19H2,1H3 |
| InChIKey | VPNOCRRQDGARGV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|