C15H24N2O — CID 79724258
4-N-(2-propoxyphenyl)cyclohexane-1,4-diamine (PubChem CID 79724258) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is 4-N-(2-propoxyphenyl)cyclohexane-1,4-diamine.
| Compound Name | 4-N-(2-propoxyphenyl)cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 79724258 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 4-N-(2-propoxyphenyl)cyclohexane-1,4-diamine |
| SMILES | CCCOc1ccccc1NC1CCC(N)CC1 |
| InChI | InChI=1S/C15H24N2O/c1-2-11-18-15-6-4-3-5-14(15)17-13-9-7-12(16)8-10-13/h3-6,12-13,17H,2,7-11,16H2,1H3 |
| InChIKey | HLHOBKBTBSOEDX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |