C19H31NO — CID 115998703
2-propoxy-N-(3,3,5,5-tetramethylcyclohexyl)aniline (PubChem CID 115998703) has the molecular formula C19H31NO and a molecular weight of 289.46 g/mol. Its IUPAC name is 2-propoxy-N-(3,3,5,5-tetramethylcyclohexyl)aniline.
| Compound Name | 2-propoxy-N-(3,3,5,5-tetramethylcyclohexyl)aniline |
|---|---|
| PubChem CID | 115998703 |
| Molecular Formula | C19H31NO |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.24 |
| IUPAC Name | 2-propoxy-N-(3,3,5,5-tetramethylcyclohexyl)aniline |
| SMILES | CCCOc1ccccc1NC1CC(C)(C)CC(C)(C)C1 |
| InChI | InChI=1S/C19H31NO/c1-6-11-21-17-10-8-7-9-16(17)20-15-12-18(2,3)14-19(4,5)13-15/h7-10,15,20H,6,11-14H2,1-5H3 |
| InChIKey | OGPTZYWLTDDKFX-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |