C17H18FNO — CID 43730188
N-(2-ethoxy-4-fluorophenyl)-2,3-dihydro-1H-inden-2-amine (PubChem CID 43730188) has the molecular formula C17H18FNO and a molecular weight of 271.34 g/mol. Its IUPAC name is N-(2-ethoxy-4-fluorophenyl)-2,3-dihydro-1H-inden-2-amine.
| Compound Name | N-(2-ethoxy-4-fluorophenyl)-2,3-dihydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 43730188 |
| Molecular Formula | C17H18FNO |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | N-(2-ethoxy-4-fluorophenyl)-2,3-dihydro-1H-inden-2-amine |
| SMILES | CCOc1cc(F)ccc1NC1Cc2ccccc2C1 |
| InChI | InChI=1S/C17H18FNO/c1-2-20-17-11-14(18)7-8-16(17)19-15-9-12-5-3-4-6-13(12)10-15/h3-8,11,15,19H,2,9-10H2,1H3 |
| InChIKey | AGUOIQFOUNAFBQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |