C15H13F2N — CID 43512842
N-(2,4-difluorophenyl)-2,3-dihydro-1H-inden-2-amine (PubChem CID 43512842) has the molecular formula C15H13F2N and a molecular weight of 245.27 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2,3-dihydro-1H-inden-2-amine.
| Compound Name | N-(2,4-difluorophenyl)-2,3-dihydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 43512842 |
| Molecular Formula | C15H13F2N |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | N-(2,4-difluorophenyl)-2,3-dihydro-1H-inden-2-amine |
| SMILES | Fc1ccc(NC2Cc3ccccc3C2)c(F)c1 |
| InChI | InChI=1S/C15H13F2N/c16-12-5-6-15(14(17)9-12)18-13-7-10-3-1-2-4-11(10)8-13/h1-6,9,13,18H,7-8H2 |
| InChIKey | BKOPWVHKQNATPW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |