C17H17F2NO — CID 103776797
1-(2,4-difluorophenyl)-2-(2,3-dihydro-1H-inden-2-ylamino)ethanol (PubChem CID 103776797) has the molecular formula C17H17F2NO and a molecular weight of 289.33 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-2-(2,3-dihydro-1H-inden-2-ylamino)ethanol.
| Compound Name | 1-(2,4-difluorophenyl)-2-(2,3-dihydro-1H-inden-2-ylamino)ethanol |
|---|---|
| PubChem CID | 103776797 |
| Molecular Formula | C17H17F2NO |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 1-(2,4-difluorophenyl)-2-(2,3-dihydro-1H-inden-2-ylamino)ethanol |
| SMILES | OC(CNC1Cc2ccccc2C1)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H17F2NO/c18-13-5-6-15(16(19)9-13)17(21)10-20-14-7-11-3-1-2-4-12(11)8-14/h1-6,9,14,17,20-21H,7-8,10H2 |
| InChIKey | ASVAYSVSJUGCMN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |