About N-(2,4-difluorophenyl)pyrrolidin-3-amine
N-(2,4-difluorophenyl)pyrrolidin-3-amine (PubChem CID 66545630) has the molecular formula C10H12F2N2
and a molecular weight of 198.22 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)pyrrolidin-3-amine.
Molecular Properties
| Compound Name | N-(2,4-difluorophenyl)pyrrolidin-3-amine |
| PubChem CID | 66545630 |
| Molecular Formula | C10H12F2N2 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | N-(2,4-difluorophenyl)pyrrolidin-3-amine |
| SMILES | Fc1ccc(NC2CCNC2)c(F)c1 |
| InChI | InChI=1S/C10H12F2N2/c11-7-1-2-10(9(12)5-7)14-8-3-4-13-6-8/h1-2,5,8,13-14H,3-4,6H2 |
| InChIKey | GGKYSEZRGBDIKR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2,4-difluorophenyl)pyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,4-difluorophenyl)pyrrolidin-3-amine?
The IUPAC name of N-(2,4-difluorophenyl)pyrrolidin-3-amine (CID 66545630) is N-(2,4-difluorophenyl)pyrrolidin-3-amine.
What is the SMILES notation for N-(2,4-difluorophenyl)pyrrolidin-3-amine?
The canonical SMILES for N-(2,4-difluorophenyl)pyrrolidin-3-amine is Fc1ccc(NC2CCNC2)c(F)c1.
What is the InChIKey of N-(2,4-difluorophenyl)pyrrolidin-3-amine?
The InChIKey is GGKYSEZRGBDIKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F2N2/c11-7-1-2-10(9(12)5-7)14-8-3-4-13-6-8/h1-2,5,8,13-14H,3-4,6H2.
What are the key properties of N-(2,4-difluorophenyl)pyrrolidin-3-amine?
N-(2,4-difluorophenyl)pyrrolidin-3-amine has a molecular weight of 198.22 g/mol, XLogP of 1.74, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,4-difluorophenyl)pyrrolidin-3-amine is sourced from PubChem (CID 66545630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).