C10H11F2NO — CID 126856726
2-(2,4-difluoroanilino)cyclobutan-1-ol (PubChem CID 126856726) has the molecular formula C10H11F2NO and a molecular weight of 199.20 g/mol. Its IUPAC name is 2-(2,4-difluoroanilino)cyclobutan-1-ol.
| Compound Name | 2-(2,4-difluoroanilino)cyclobutan-1-ol |
|---|---|
| PubChem CID | 126856726 |
| Molecular Formula | C10H11F2NO |
| Molecular Weight | 199.20 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 2-(2,4-difluoroanilino)cyclobutan-1-ol |
| SMILES | OC1CCC1Nc1ccc(F)cc1F |
| InChI | InChI=1S/C10H11F2NO/c11-6-1-2-8(7(12)5-6)13-9-3-4-10(9)14/h1-2,5,9-10,13-14H,3-4H2 |
| InChIKey | CIIMCZVPTSKTPQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.20 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |