C12H14F3NO — CID 102731209
trans-(1R,2R)-2-(2,4,5-trifluoroanilino)cyclohexan-1-ol (PubChem CID 102731209) has the molecular formula C12H14F3NO and a molecular weight of 245.24 g/mol. Its IUPAC name is trans-(1R,2R)-2-(2,4,5-trifluoroanilino)cyclohexan-1-ol.
| Compound Name | trans-(1R,2R)-2-(2,4,5-trifluoroanilino)cyclohexan-1-ol |
|---|---|
| PubChem CID | 102731209 |
| Molecular Formula | C12H14F3NO |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | trans-(1R,2R)-2-(2,4,5-trifluoroanilino)cyclohexan-1-ol |
| SMILES | O[C@@H]1CCCC[C@H]1Nc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C12H14F3NO/c13-7-5-9(15)11(6-8(7)14)16-10-3-1-2-4-12(10)17/h5-6,10,12,16-17H,1-4H2/t10-,12-/m1/s1 |
| InChIKey | WITCJDOZRZPLON-ZYHUDNBSSA-N |
| XLogP | 2.82 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|