C11H14FNO — CID 93345872
trans-(1S,2S)-2-(2-fluoroanilino)cyclopentan-1-ol (PubChem CID 93345872) has the molecular formula C11H14FNO and a molecular weight of 195.24 g/mol. Its IUPAC name is trans-(1S,2S)-2-(2-fluoroanilino)cyclopentan-1-ol.
| Compound Name | trans-(1S,2S)-2-(2-fluoroanilino)cyclopentan-1-ol |
|---|---|
| PubChem CID | 93345872 |
| Molecular Formula | C11H14FNO |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | trans-(1S,2S)-2-(2-fluoroanilino)cyclopentan-1-ol |
| SMILES | O[C@H]1CCC[C@@H]1Nc1ccccc1F |
| InChI | InChI=1S/C11H14FNO/c12-8-4-1-2-5-9(8)13-10-6-3-7-11(10)14/h1-2,4-5,10-11,13-14H,3,6-7H2/t10-,11-/m0/s1 |
| InChIKey | AIVZWMLWAYSUHL-QWRGUYRKSA-N |
| XLogP | 2.15 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |