C11H13F3N2 — CID 62814853
N-(2,4,5-trifluorophenyl)piperidin-3-amine (PubChem CID 62814853) has the molecular formula C11H13F3N2 and a molecular weight of 230.23 g/mol. Its IUPAC name is N-(2,4,5-trifluorophenyl)piperidin-3-amine.
| Compound Name | N-(2,4,5-trifluorophenyl)piperidin-3-amine |
|---|---|
| PubChem CID | 62814853 |
| Molecular Formula | C11H13F3N2 |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | N-(2,4,5-trifluorophenyl)piperidin-3-amine |
| SMILES | Fc1cc(F)c(NC2CCCNC2)cc1F |
| InChI | InChI=1S/C11H13F3N2/c12-8-4-10(14)11(5-9(8)13)16-7-2-1-3-15-6-7/h4-5,7,15-16H,1-3,6H2 |
| InChIKey | QNXADYIPIIFJJZ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|