C10H12Br2N2 — CID 79725192
N-(2,4-dibromophenyl)pyrrolidin-3-amine (PubChem CID 79725192) has the molecular formula C10H12Br2N2 and a molecular weight of 320.03 g/mol. Its IUPAC name is N-(2,4-dibromophenyl)pyrrolidin-3-amine.
| Compound Name | N-(2,4-dibromophenyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 79725192 |
| Molecular Formula | C10H12Br2N2 |
| Molecular Weight | 320.03 g/mol |
| Exact Mass | 317.94 |
| IUPAC Name | N-(2,4-dibromophenyl)pyrrolidin-3-amine |
| SMILES | Brc1ccc(NC2CCNC2)c(Br)c1 |
| InChI | InChI=1S/C10H12Br2N2/c11-7-1-2-10(9(12)5-7)14-8-3-4-13-6-8/h1-2,5,8,13-14H,3-4,6H2 |
| InChIKey | LBLDMFDWZQDJGZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.03 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |