C12H16Br2N2 — CID 43683065
N-(2,4-dibromophenyl)-1-methylpiperidin-4-amine (PubChem CID 43683065) has the molecular formula C12H16Br2N2 and a molecular weight of 348.08 g/mol. Its IUPAC name is N-(2,4-dibromophenyl)-1-methylpiperidin-4-amine.
| Compound Name | N-(2,4-dibromophenyl)-1-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 43683065 |
| Molecular Formula | C12H16Br2N2 |
| Molecular Weight | 348.08 g/mol |
| Exact Mass | 345.97 |
| IUPAC Name | N-(2,4-dibromophenyl)-1-methylpiperidin-4-amine |
| SMILES | CN1CCC(Nc2ccc(Br)cc2Br)CC1 |
| InChI | InChI=1S/C12H16Br2N2/c1-16-6-4-10(5-7-16)15-12-3-2-9(13)8-11(12)14/h2-3,8,10,15H,4-7H2,1H3 |
| InChIKey | WEHDJGMNROQSMR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.08 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |