C13H18Br2N2 — CID 43683069
N-(2,4-dibromophenyl)-1-ethylpiperidin-4-amine (PubChem CID 43683069) has the molecular formula C13H18Br2N2 and a molecular weight of 362.11 g/mol. Its IUPAC name is N-(2,4-dibromophenyl)-1-ethylpiperidin-4-amine.
| Compound Name | N-(2,4-dibromophenyl)-1-ethylpiperidin-4-amine |
|---|---|
| PubChem CID | 43683069 |
| Molecular Formula | C13H18Br2N2 |
| Molecular Weight | 362.11 g/mol |
| Exact Mass | 359.98 |
| IUPAC Name | N-(2,4-dibromophenyl)-1-ethylpiperidin-4-amine |
| SMILES | CCN1CCC(Nc2ccc(Br)cc2Br)CC1 |
| InChI | InChI=1S/C13H18Br2N2/c1-2-17-7-5-11(6-8-17)16-13-4-3-10(14)9-12(13)15/h3-4,9,11,16H,2,5-8H2,1H3 |
| InChIKey | JFCPQIIQZXFXEW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.11 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |