C13H17BrCl2N2 — CID 28993181
N-(4-bromo-2,6-dichlorophenyl)-1-ethylpiperidin-4-amine (PubChem CID 28993181) has the molecular formula C13H17BrCl2N2 and a molecular weight of 352.10 g/mol. Its IUPAC name is N-(4-bromo-2,6-dichlorophenyl)-1-ethylpiperidin-4-amine.
| Compound Name | N-(4-bromo-2,6-dichlorophenyl)-1-ethylpiperidin-4-amine |
|---|---|
| PubChem CID | 28993181 |
| Molecular Formula | C13H17BrCl2N2 |
| Molecular Weight | 352.10 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | N-(4-bromo-2,6-dichlorophenyl)-1-ethylpiperidin-4-amine |
| SMILES | CCN1CCC(Nc2c(Cl)cc(Br)cc2Cl)CC1 |
| InChI | InChI=1S/C13H17BrCl2N2/c1-2-18-5-3-10(4-6-18)17-13-11(15)7-9(14)8-12(13)16/h7-8,10,17H,2-6H2,1H3 |
| InChIKey | QSGGVQKNJKPNJT-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.10 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |