C15H20BrCl2N — CID 63425626
4-bromo-2,6-dichloro-N-(4-propylcyclohexyl)aniline (PubChem CID 63425626) has the molecular formula C15H20BrCl2N and a molecular weight of 365.14 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-(4-propylcyclohexyl)aniline.
| Compound Name | 4-bromo-2,6-dichloro-N-(4-propylcyclohexyl)aniline |
|---|---|
| PubChem CID | 63425626 |
| Molecular Formula | C15H20BrCl2N |
| Molecular Weight | 365.14 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-(4-propylcyclohexyl)aniline |
| SMILES | CCCC1CCC(Nc2c(Cl)cc(Br)cc2Cl)CC1 |
| InChI | InChI=1S/C15H20BrCl2N/c1-2-3-10-4-6-12(7-5-10)19-15-13(17)8-11(16)9-14(15)18/h8-10,12,19H,2-7H2,1H3 |
| InChIKey | FQVOCDZMXSLECV-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.14 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |