C11H12BrCl2NS — CID 43511379
N-(4-bromo-2,6-dichlorophenyl)thian-4-amine (PubChem CID 43511379) has the molecular formula C11H12BrCl2NS and a molecular weight of 341.10 g/mol. Its IUPAC name is N-(4-bromo-2,6-dichlorophenyl)thian-4-amine.
| Compound Name | N-(4-bromo-2,6-dichlorophenyl)thian-4-amine |
|---|---|
| PubChem CID | 43511379 |
| Molecular Formula | C11H12BrCl2NS |
| Molecular Weight | 341.10 g/mol |
| Exact Mass | 338.93 |
| IUPAC Name | N-(4-bromo-2,6-dichlorophenyl)thian-4-amine |
| SMILES | Clc1cc(Br)cc(Cl)c1NC1CCSCC1 |
| InChI | InChI=1S/C11H12BrCl2NS/c12-7-5-9(13)11(10(14)6-7)15-8-1-3-16-4-2-8/h5-6,8,15H,1-4H2 |
| InChIKey | XPIYNUCLJZHYFA-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.10 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |