C13H16BrCl2N — CID 80692270
4-bromo-2,6-dichloro-N-(3,3-dimethylcyclopentyl)aniline (PubChem CID 80692270) has the molecular formula C13H16BrCl2N and a molecular weight of 337.09 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-(3,3-dimethylcyclopentyl)aniline.
| Compound Name | 4-bromo-2,6-dichloro-N-(3,3-dimethylcyclopentyl)aniline |
|---|---|
| PubChem CID | 80692270 |
| Molecular Formula | C13H16BrCl2N |
| Molecular Weight | 337.09 g/mol |
| Exact Mass | 334.98 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-(3,3-dimethylcyclopentyl)aniline |
| SMILES | CC1(C)CCC(Nc2c(Cl)cc(Br)cc2Cl)C1 |
| InChI | InChI=1S/C13H16BrCl2N/c1-13(2)4-3-9(7-13)17-12-10(15)5-8(14)6-11(12)16/h5-6,9,17H,3-4,7H2,1-2H3 |
| InChIKey | AHARYSQBJJTXAU-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.09 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |