C14H19Cl3N2 — CID 65074238
1-ethyl-N-(2,4,6-trichlorophenyl)azepan-4-amine (PubChem CID 65074238) has the molecular formula C14H19Cl3N2 and a molecular weight of 321.68 g/mol. Its IUPAC name is 1-ethyl-N-(2,4,6-trichlorophenyl)azepan-4-amine.
| Compound Name | 1-ethyl-N-(2,4,6-trichlorophenyl)azepan-4-amine |
|---|---|
| PubChem CID | 65074238 |
| Molecular Formula | C14H19Cl3N2 |
| Molecular Weight | 321.68 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 1-ethyl-N-(2,4,6-trichlorophenyl)azepan-4-amine |
| SMILES | CCN1CCCC(Nc2c(Cl)cc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C14H19Cl3N2/c1-2-19-6-3-4-11(5-7-19)18-14-12(16)8-10(15)9-13(14)17/h8-9,11,18H,2-7H2,1H3 |
| InChIKey | MJSWTMQLBSOTDV-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.68 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |