C11H12BrF3N2 — CID 114042706
N-[2-bromo-5-(trifluoromethyl)phenyl]pyrrolidin-3-amine (PubChem CID 114042706) has the molecular formula C11H12BrF3N2 and a molecular weight of 309.13 g/mol. Its IUPAC name is N-[2-bromo-5-(trifluoromethyl)phenyl]pyrrolidin-3-amine.
| Compound Name | N-[2-bromo-5-(trifluoromethyl)phenyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 114042706 |
| Molecular Formula | C11H12BrF3N2 |
| Molecular Weight | 309.13 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | N-[2-bromo-5-(trifluoromethyl)phenyl]pyrrolidin-3-amine |
| SMILES | FC(F)(F)c1ccc(Br)c(NC2CCNC2)c1 |
| InChI | InChI=1S/C11H12BrF3N2/c12-9-2-1-7(11(13,14)15)5-10(9)17-8-3-4-16-6-8/h1-2,5,8,16-17H,3-4,6H2 |
| InChIKey | APSDCZXJIGRXJR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.13 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |