C17H16F3N3S — CID 139346514
N-pyrrolidin-3-yl-3-(trifluoromethyl)-10H-phenothiazin-1-amine (PubChem CID 139346514) has the molecular formula C17H16F3N3S and a molecular weight of 351.40 g/mol. Its IUPAC name is N-pyrrolidin-3-yl-3-(trifluoromethyl)-10H-phenothiazin-1-amine.
| Compound Name | N-pyrrolidin-3-yl-3-(trifluoromethyl)-10H-phenothiazin-1-amine |
|---|---|
| PubChem CID | 139346514 |
| Molecular Formula | C17H16F3N3S |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | N-pyrrolidin-3-yl-3-(trifluoromethyl)-10H-phenothiazin-1-amine |
| SMILES | FC(F)(F)c1cc(NC2CCNC2)c2c(c1)Sc1ccccc1N2 |
| InChI | InChI=1S/C17H16F3N3S/c18-17(19,20)10-7-13(22-11-5-6-21-9-11)16-15(8-10)24-14-4-2-1-3-12(14)23-16/h1-4,7-8,11,21-23H,5-6,9H2 |
| InChIKey | BCIUENOKYGWPCA-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |